2-methoxyethyl 3-methyl-4-oxo-6-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Chemical Structure Depiction of
2-methoxyethyl 3-methyl-4-oxo-6-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
2-methoxyethyl 3-methyl-4-oxo-6-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | 8015-3980 |
| Compound Name: | 2-methoxyethyl 3-methyl-4-oxo-6-(3,4,5-trimethoxyphenyl)-4,5,6,7-tetrahydro-1H-indole-2-carboxylate |
| Molecular Weight: | 417.46 |
| Molecular Formula: | C22 H27 N O7 |
| Smiles: | Cc1c2C(CC(Cc2[nH]c1C(=O)OCCOC)c1cc(c(c(c1)OC)OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1267 |
| logD: | 2.1267 |
| logSw: | -2.5695 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.409 |
| InChI Key: | WWJPFCJOWQNFPD-CYBMUJFWSA-N |