5-({[5-(4-chlorophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)quinolin-8-ol
Chemical Structure Depiction of
5-({[5-(4-chlorophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)quinolin-8-ol
5-({[5-(4-chlorophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)quinolin-8-ol
Compound characteristics
| Compound ID: | 8015-4202 |
| Compound Name: | 5-({[5-(4-chlorophenyl)-4-phenyl-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)quinolin-8-ol |
| Molecular Weight: | 444.94 |
| Molecular Formula: | C24 H17 Cl N4 O S |
| Smiles: | C(c1ccc(c2c1cccn2)O)Sc1nnc(c2ccc(cc2)[Cl])n1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.859 |
| logD: | 5.8506 |
| logSw: | -6.0981 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.794 |
| InChI Key: | UWTAAGZZRSQCHE-UHFFFAOYSA-N |