2,4,5-trichloro-N-(6-cyano-2H-1,3-benzodioxol-5-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
2,4,5-trichloro-N-(6-cyano-2H-1,3-benzodioxol-5-yl)benzene-1-sulfonamide
2,4,5-trichloro-N-(6-cyano-2H-1,3-benzodioxol-5-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8015-4345 |
| Compound Name: | 2,4,5-trichloro-N-(6-cyano-2H-1,3-benzodioxol-5-yl)benzene-1-sulfonamide |
| Molecular Weight: | 405.64 |
| Molecular Formula: | C14 H7 Cl3 N2 O4 S |
| Smiles: | C1Oc2cc(C#N)c(cc2O1)NS(c1cc(c(cc1[Cl])[Cl])[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2253 |
| logD: | 1.1764 |
| logSw: | -4.5305 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.362 |
| InChI Key: | PKXQHESXTSJIAN-UHFFFAOYSA-N |