5-{[(2-bromophenyl)methyl]sulfanyl}-1-(naphthalen-1-yl)-1H-tetrazole
Chemical Structure Depiction of
5-{[(2-bromophenyl)methyl]sulfanyl}-1-(naphthalen-1-yl)-1H-tetrazole
5-{[(2-bromophenyl)methyl]sulfanyl}-1-(naphthalen-1-yl)-1H-tetrazole
Compound characteristics
| Compound ID: | 8015-4593 |
| Compound Name: | 5-{[(2-bromophenyl)methyl]sulfanyl}-1-(naphthalen-1-yl)-1H-tetrazole |
| Molecular Weight: | 397.29 |
| Molecular Formula: | C18 H13 Br N4 S |
| Smiles: | C(c1ccccc1[Br])Sc1nnnn1c1cccc2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 5.4614 |
| logD: | 5.4614 |
| logSw: | -6.9898 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.316 |
| InChI Key: | MGOFUATVTWZSON-UHFFFAOYSA-N |