2-(2,3-dihydro-1,4-benzodioxin-2-yl)-N-(2-phenylethyl)acetamide
Chemical Structure Depiction of
2-(2,3-dihydro-1,4-benzodioxin-2-yl)-N-(2-phenylethyl)acetamide
2-(2,3-dihydro-1,4-benzodioxin-2-yl)-N-(2-phenylethyl)acetamide
Compound characteristics
| Compound ID: | 8015-4920 |
| Compound Name: | 2-(2,3-dihydro-1,4-benzodioxin-2-yl)-N-(2-phenylethyl)acetamide |
| Molecular Weight: | 297.35 |
| Molecular Formula: | C18 H19 N O3 |
| Smiles: | C(CNC(CC1COc2ccccc2O1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3067 |
| logD: | 2.3067 |
| logSw: | -2.7251 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.959 |
| InChI Key: | KONGCBCTWMIGJS-HNNXBMFYSA-N |