ethyl [(6-methyl-3-oxo-1,3-dihydrofuro[3,4-c]pyridin-4-yl)sulfanyl]acetate
Chemical Structure Depiction of
ethyl [(6-methyl-3-oxo-1,3-dihydrofuro[3,4-c]pyridin-4-yl)sulfanyl]acetate
ethyl [(6-methyl-3-oxo-1,3-dihydrofuro[3,4-c]pyridin-4-yl)sulfanyl]acetate
Compound characteristics
| Compound ID: | 8015-5189 |
| Compound Name: | ethyl [(6-methyl-3-oxo-1,3-dihydrofuro[3,4-c]pyridin-4-yl)sulfanyl]acetate |
| Molecular Weight: | 267.3 |
| Molecular Formula: | C12 H13 N O4 S |
| Smiles: | CCOC(CSc1c2C(=O)OCc2cc(C)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5749 |
| logD: | 1.5749 |
| logSw: | -1.8491 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 51.523 |
| InChI Key: | HENSCJMPPYGVHX-UHFFFAOYSA-N |