6-methyl-N-[4-(thiophen-2-yl)-1,3-thiazol-2-yl]pyridin-2-amine
Chemical Structure Depiction of
6-methyl-N-[4-(thiophen-2-yl)-1,3-thiazol-2-yl]pyridin-2-amine
6-methyl-N-[4-(thiophen-2-yl)-1,3-thiazol-2-yl]pyridin-2-amine
Compound characteristics
| Compound ID: | 8015-5635 |
| Compound Name: | 6-methyl-N-[4-(thiophen-2-yl)-1,3-thiazol-2-yl]pyridin-2-amine |
| Molecular Weight: | 273.38 |
| Molecular Formula: | C13 H11 N3 S2 |
| Smiles: | Cc1cccc(Nc2nc(cs2)c2cccs2)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.646 |
| logD: | 4.5828 |
| logSw: | -4.4273 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.9333 |
| InChI Key: | GNUGUUFOOMYNGW-UHFFFAOYSA-N |