1-{4-[(2',4'-dimethyl[4,5'-bi-1,3-thiazol]-2-yl)amino]phenyl}ethan-1-one
Chemical Structure Depiction of
1-{4-[(2',4'-dimethyl[4,5'-bi-1,3-thiazol]-2-yl)amino]phenyl}ethan-1-one
1-{4-[(2',4'-dimethyl[4,5'-bi-1,3-thiazol]-2-yl)amino]phenyl}ethan-1-one
Compound characteristics
| Compound ID: | 8015-5641 |
| Compound Name: | 1-{4-[(2',4'-dimethyl[4,5'-bi-1,3-thiazol]-2-yl)amino]phenyl}ethan-1-one |
| Molecular Weight: | 329.44 |
| Molecular Formula: | C16 H15 N3 O S2 |
| Smiles: | CC(c1ccc(cc1)Nc1nc(cs1)c1c(C)nc(C)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3028 |
| logD: | 4.3021 |
| logSw: | -4.2606 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.141 |
| InChI Key: | FTZINVFVENCLEX-UHFFFAOYSA-N |