5-(4-nitrophenyl)-3-[4-(1H-pyrrol-1-yl)phenyl]-1,2,4-oxadiazole
Chemical Structure Depiction of
5-(4-nitrophenyl)-3-[4-(1H-pyrrol-1-yl)phenyl]-1,2,4-oxadiazole
5-(4-nitrophenyl)-3-[4-(1H-pyrrol-1-yl)phenyl]-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | 8015-5656 |
| Compound Name: | 5-(4-nitrophenyl)-3-[4-(1H-pyrrol-1-yl)phenyl]-1,2,4-oxadiazole |
| Molecular Weight: | 332.32 |
| Molecular Formula: | C18 H12 N4 O3 |
| Smiles: | c1ccn(c1)c1ccc(cc1)c1nc(c2ccc(cc2)[N+]([O-])=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.9512 |
| logD: | 4.9512 |
| logSw: | -5.0978 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 69.012 |
| InChI Key: | HTEKBKFIMNBKSX-UHFFFAOYSA-N |