N,N-diethyl-2-(2-methyl-4H-[1,3]thiazolo[5,4-b]indol-4-yl)ethan-1-amine--hydrogen chloride (1/1)
Chemical Structure Depiction of
N,N-diethyl-2-(2-methyl-4H-[1,3]thiazolo[5,4-b]indol-4-yl)ethan-1-amine--hydrogen chloride (1/1)
N,N-diethyl-2-(2-methyl-4H-[1,3]thiazolo[5,4-b]indol-4-yl)ethan-1-amine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 8015-5710 |
| Compound Name: | N,N-diethyl-2-(2-methyl-4H-[1,3]thiazolo[5,4-b]indol-4-yl)ethan-1-amine--hydrogen chloride (1/1) |
| Molecular Weight: | 323.89 |
| Molecular Formula: | C16 H21 N3 S |
| Salt: | HCl |
| Smiles: | CCN(CC)CCn1c2ccccc2c2c1sc(C)n2 |
| Stereo: | ACHIRAL |
| logP: | 3.9151 |
| logD: | 3.2043 |
| logSw: | -3.9399 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 15.0071 |
| InChI Key: | MKWNXTOAYQUENM-UHFFFAOYSA-N |