4-(4-methoxyphenyl)-N-(4-methylphenyl)-1,3-thiazol-2-amine
Chemical Structure Depiction of
4-(4-methoxyphenyl)-N-(4-methylphenyl)-1,3-thiazol-2-amine
4-(4-methoxyphenyl)-N-(4-methylphenyl)-1,3-thiazol-2-amine
Compound characteristics
| Compound ID: | 8015-6336 |
| Compound Name: | 4-(4-methoxyphenyl)-N-(4-methylphenyl)-1,3-thiazol-2-amine |
| Molecular Weight: | 296.39 |
| Molecular Formula: | C17 H16 N2 O S |
| Smiles: | Cc1ccc(cc1)Nc1nc(cs1)c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.6918 |
| logD: | 5.6918 |
| logSw: | -5.6048 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.4694 |
| InChI Key: | KUSZSJKYIJJGIU-UHFFFAOYSA-N |