5-[2-(2-fluorophenyl)ethenyl]-3-[4-(1H-pyrrol-1-yl)phenyl]-1,2,4-oxadiazole
Chemical Structure Depiction of
5-[2-(2-fluorophenyl)ethenyl]-3-[4-(1H-pyrrol-1-yl)phenyl]-1,2,4-oxadiazole
5-[2-(2-fluorophenyl)ethenyl]-3-[4-(1H-pyrrol-1-yl)phenyl]-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | 8015-6738 |
| Compound Name: | 5-[2-(2-fluorophenyl)ethenyl]-3-[4-(1H-pyrrol-1-yl)phenyl]-1,2,4-oxadiazole |
| Molecular Weight: | 331.35 |
| Molecular Formula: | C20 H14 F N3 O |
| Smiles: | C(=C/c1nc(c2ccc(cc2)n2cccc2)no1)\c1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 5.821 |
| logD: | 5.821 |
| logSw: | -6.1695 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 35.296 |
| InChI Key: | JIIUIAOHVFDUSY-UHFFFAOYSA-N |