(oxolan-2-yl)methyl 6-(4-ethoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Chemical Structure Depiction of
(oxolan-2-yl)methyl 6-(4-ethoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
(oxolan-2-yl)methyl 6-(4-ethoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | 8015-6759 |
| Compound Name: | (oxolan-2-yl)methyl 6-(4-ethoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate |
| Molecular Weight: | 397.47 |
| Molecular Formula: | C23 H27 N O5 |
| Smiles: | CCOc1ccc(cc1)C1CC(c2c(C)c(C(=O)OCC3CCCO3)[nH]c2C1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.4576 |
| logD: | 3.4576 |
| logSw: | -3.6629 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.676 |
| InChI Key: | XQQJCCXGDIXHOK-UHFFFAOYSA-N |