4-(4-hydroxyphenyl)-6-(3-hydroxypropyl)-1-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidine-2,5-dione
Chemical Structure Depiction of
4-(4-hydroxyphenyl)-6-(3-hydroxypropyl)-1-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidine-2,5-dione
4-(4-hydroxyphenyl)-6-(3-hydroxypropyl)-1-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidine-2,5-dione
Compound characteristics
| Compound ID: | 8015-9176 |
| Compound Name: | 4-(4-hydroxyphenyl)-6-(3-hydroxypropyl)-1-methyl-3,4,6,7-tetrahydro-1H-pyrrolo[3,4-d]pyrimidine-2,5-dione |
| Molecular Weight: | 317.34 |
| Molecular Formula: | C16 H19 N3 O4 |
| Smiles: | CN1C2CN(CCCO)C(C=2C(c2ccc(cc2)O)NC1=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.2676 |
| logD: | -0.2721 |
| logSw: | -1.6455 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 79.025 |
| InChI Key: | CPSIPBYYQQHETH-AWEZNQCLSA-N |