2-(4-chloro-3-methylphenoxy)-N-[(2-methylquinolin-4-yl)methyl]acetamide
Chemical Structure Depiction of
2-(4-chloro-3-methylphenoxy)-N-[(2-methylquinolin-4-yl)methyl]acetamide
2-(4-chloro-3-methylphenoxy)-N-[(2-methylquinolin-4-yl)methyl]acetamide
Compound characteristics
| Compound ID: | 8015-9271 |
| Compound Name: | 2-(4-chloro-3-methylphenoxy)-N-[(2-methylquinolin-4-yl)methyl]acetamide |
| Molecular Weight: | 354.83 |
| Molecular Formula: | C20 H19 Cl N2 O2 |
| Smiles: | Cc1cc(ccc1[Cl])OCC(NCc1cc(C)nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5538 |
| logD: | 4.5537 |
| logSw: | -4.4357 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.075 |
| InChI Key: | ROTYZDXUMIRROV-UHFFFAOYSA-N |