2,4-dichloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-{[(oxolan-2-yl)methyl]sulfamoyl}benzamide
Chemical Structure Depiction of
2,4-dichloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-{[(oxolan-2-yl)methyl]sulfamoyl}benzamide
2,4-dichloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-{[(oxolan-2-yl)methyl]sulfamoyl}benzamide
Compound characteristics
| Compound ID: | 8016-0512 |
| Compound Name: | 2,4-dichloro-N-[2-(3,4-dimethoxyphenyl)ethyl]-5-{[(oxolan-2-yl)methyl]sulfamoyl}benzamide |
| Molecular Weight: | 517.43 |
| Molecular Formula: | C22 H26 Cl2 N2 O6 S |
| Smiles: | COc1ccc(CCNC(c2cc(c(cc2[Cl])[Cl])S(NCC2CCCO2)(=O)=O)=O)cc1OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8979 |
| logD: | 2.8975 |
| logSw: | -3.7121 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 90.167 |
| InChI Key: | QRNDEIWTAPOIHL-OAHLLOKOSA-N |