4-[(2-chloro-4-fluorophenoxy)methyl]-6-(piperidin-1-yl)-1,3,5-triazin-2-amine
Chemical Structure Depiction of
4-[(2-chloro-4-fluorophenoxy)methyl]-6-(piperidin-1-yl)-1,3,5-triazin-2-amine
4-[(2-chloro-4-fluorophenoxy)methyl]-6-(piperidin-1-yl)-1,3,5-triazin-2-amine
Compound characteristics
| Compound ID: | 8016-0629 |
| Compound Name: | 4-[(2-chloro-4-fluorophenoxy)methyl]-6-(piperidin-1-yl)-1,3,5-triazin-2-amine |
| Molecular Weight: | 337.78 |
| Molecular Formula: | C15 H17 Cl F N5 O |
| Smiles: | C1CCN(CC1)c1nc(COc2ccc(cc2[Cl])F)nc(N)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.5216 |
| logD: | 3.5216 |
| logSw: | -3.6237 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.255 |
| InChI Key: | WCICGDHZKVDNAN-UHFFFAOYSA-N |