{1-[2-(2-bromoanilino)-2-oxoethyl]cyclopentyl}acetic acid
Chemical Structure Depiction of
{1-[2-(2-bromoanilino)-2-oxoethyl]cyclopentyl}acetic acid
{1-[2-(2-bromoanilino)-2-oxoethyl]cyclopentyl}acetic acid
Compound characteristics
| Compound ID: | 8016-0685 |
| Compound Name: | {1-[2-(2-bromoanilino)-2-oxoethyl]cyclopentyl}acetic acid |
| Molecular Weight: | 340.21 |
| Molecular Formula: | C15 H18 Br N O3 |
| Smiles: | C1CCC(C1)(CC(O)=O)CC(Nc1ccccc1[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 2.4161 |
| logD: | -0.1197 |
| logSw: | -2.8095 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.36 |
| InChI Key: | DIWJBHBULAFMQR-UHFFFAOYSA-N |