2-(4-methoxyanilino)[1,3]thiazolo[4,5-b]pyridine-5,7-diol
Chemical Structure Depiction of
2-(4-methoxyanilino)[1,3]thiazolo[4,5-b]pyridine-5,7-diol
2-(4-methoxyanilino)[1,3]thiazolo[4,5-b]pyridine-5,7-diol
Compound characteristics
| Compound ID: | 8016-0857 |
| Compound Name: | 2-(4-methoxyanilino)[1,3]thiazolo[4,5-b]pyridine-5,7-diol |
| Molecular Weight: | 289.31 |
| Molecular Formula: | C13 H11 N3 O3 S |
| Smiles: | COc1ccc(cc1)Nc1nc2c(c(cc(n2)O)O)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.0943 |
| logD: | 2.3209 |
| logSw: | -3.3142 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 70.205 |
| InChI Key: | XTEYHQOCUFPHQB-UHFFFAOYSA-N |