4-(4-hydroxy-1,2,5-trimethylpiperidin-4-yl)-2-methylbut-3-yn-2-yl benzoate
Chemical Structure Depiction of
4-(4-hydroxy-1,2,5-trimethylpiperidin-4-yl)-2-methylbut-3-yn-2-yl benzoate
4-(4-hydroxy-1,2,5-trimethylpiperidin-4-yl)-2-methylbut-3-yn-2-yl benzoate
Compound characteristics
| Compound ID: | 8016-0946 |
| Compound Name: | 4-(4-hydroxy-1,2,5-trimethylpiperidin-4-yl)-2-methylbut-3-yn-2-yl benzoate |
| Molecular Weight: | 329.44 |
| Molecular Formula: | C20 H27 N O3 |
| Smiles: | CC1CN(C)C(C)CC1(C#CC(C)(C)OC(c1ccccc1)=O)O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.1715 |
| logD: | 1.3583 |
| logSw: | -3.125 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.283 |
| InChI Key: | VUEVYIBTFKAOPT-UHFFFAOYSA-N |