3-(methylsulfanyl)-8-(morpholine-4-sulfonyl)[1,2,4]triazolo[4,3-a]pyridine
Chemical Structure Depiction of
3-(methylsulfanyl)-8-(morpholine-4-sulfonyl)[1,2,4]triazolo[4,3-a]pyridine
3-(methylsulfanyl)-8-(morpholine-4-sulfonyl)[1,2,4]triazolo[4,3-a]pyridine
Compound characteristics
| Compound ID: | 8016-1225 |
| Compound Name: | 3-(methylsulfanyl)-8-(morpholine-4-sulfonyl)[1,2,4]triazolo[4,3-a]pyridine |
| Molecular Weight: | 314.38 |
| Molecular Formula: | C11 H14 N4 O3 S2 |
| Smiles: | CSc1nnc2c(cccn12)S(N1CCOCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.181 |
| logD: | 0.181 |
| logSw: | -1.6795 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 62.596 |
| InChI Key: | VNDNVSWZQVWLNB-UHFFFAOYSA-N |