methyl [1-(4-chlorophenyl)-5-cyano-4-methyl-6-oxo-1,6-dihydropyridazin-3-yl]carbamate
Chemical Structure Depiction of
methyl [1-(4-chlorophenyl)-5-cyano-4-methyl-6-oxo-1,6-dihydropyridazin-3-yl]carbamate
methyl [1-(4-chlorophenyl)-5-cyano-4-methyl-6-oxo-1,6-dihydropyridazin-3-yl]carbamate
Compound characteristics
| Compound ID: | 8016-1475 |
| Compound Name: | methyl [1-(4-chlorophenyl)-5-cyano-4-methyl-6-oxo-1,6-dihydropyridazin-3-yl]carbamate |
| Molecular Weight: | 318.72 |
| Molecular Formula: | C14 H11 Cl N4 O3 |
| Smiles: | CC1=C(C#N)C(N(c2ccc(cc2)[Cl])N=C1NC(=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9055 |
| logD: | -0.8712 |
| logSw: | -2.7948 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.811 |
| InChI Key: | ICJGEEGWUDUCCM-UHFFFAOYSA-N |