6,7-dibromo-2-butoxy-3-chloroquinoxaline
Chemical Structure Depiction of
6,7-dibromo-2-butoxy-3-chloroquinoxaline
6,7-dibromo-2-butoxy-3-chloroquinoxaline
Compound characteristics
| Compound ID: | 8016-1559 |
| Compound Name: | 6,7-dibromo-2-butoxy-3-chloroquinoxaline |
| Molecular Weight: | 394.49 |
| Molecular Formula: | C12 H11 Br2 Cl N2 O |
| Smiles: | CCCCOc1c(nc2cc(c(cc2n1)[Br])[Br])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.6051 |
| logD: | 5.6051 |
| logSw: | -5.8113 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 25.9841 |
| InChI Key: | NNEFVGXBEWGAGM-UHFFFAOYSA-N |