1-[(4-benzylpiperazin-1-yl)methyl]-4-bromo-5-methyl-1H-indole-2,3-dione
Chemical Structure Depiction of
1-[(4-benzylpiperazin-1-yl)methyl]-4-bromo-5-methyl-1H-indole-2,3-dione
1-[(4-benzylpiperazin-1-yl)methyl]-4-bromo-5-methyl-1H-indole-2,3-dione
Compound characteristics
| Compound ID: | 8016-1887 |
| Compound Name: | 1-[(4-benzylpiperazin-1-yl)methyl]-4-bromo-5-methyl-1H-indole-2,3-dione |
| Molecular Weight: | 428.33 |
| Molecular Formula: | C21 H22 Br N3 O2 |
| Smiles: | Cc1ccc2c(C(C(N2CN2CCN(CC2)Cc2ccccc2)=O)=O)c1[Br] |
| Stereo: | ACHIRAL |
| logP: | 3.4214 |
| logD: | 2.4544 |
| logSw: | -3.6406 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 37.82 |
| InChI Key: | HWSITKGBWKQEAO-UHFFFAOYSA-N |