1-[(tricyclo[3.3.1.1~3,7~]decane-1-carbonyl)amino]propan-2-yl thiophene-2-carboxylate
Chemical Structure Depiction of
1-[(tricyclo[3.3.1.1~3,7~]decane-1-carbonyl)amino]propan-2-yl thiophene-2-carboxylate
1-[(tricyclo[3.3.1.1~3,7~]decane-1-carbonyl)amino]propan-2-yl thiophene-2-carboxylate
Compound characteristics
| Compound ID: | 8016-1909 |
| Compound Name: | 1-[(tricyclo[3.3.1.1~3,7~]decane-1-carbonyl)amino]propan-2-yl thiophene-2-carboxylate |
| Molecular Weight: | 347.47 |
| Molecular Formula: | C19 H25 N O3 S |
| Smiles: | CC(CNC(C12CC3CC(CC(C3)C2)C1)=O)OC(c1cccs1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5938 |
| logD: | 4.5938 |
| logSw: | -4.3512 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.019 |
| InChI Key: | BPMYDRULYJYLSZ-UHSVVUDUSA-N |