2-[5-(4-methoxyphenyl)-2H-tetrazol-2-yl]-N-[2-(methylsulfanyl)phenyl]acetamide
Chemical Structure Depiction of
2-[5-(4-methoxyphenyl)-2H-tetrazol-2-yl]-N-[2-(methylsulfanyl)phenyl]acetamide
2-[5-(4-methoxyphenyl)-2H-tetrazol-2-yl]-N-[2-(methylsulfanyl)phenyl]acetamide
Compound characteristics
| Compound ID: | 8016-2029 |
| Compound Name: | 2-[5-(4-methoxyphenyl)-2H-tetrazol-2-yl]-N-[2-(methylsulfanyl)phenyl]acetamide |
| Molecular Weight: | 355.42 |
| Molecular Formula: | C17 H17 N5 O2 S |
| Smiles: | COc1ccc(cc1)c1nnn(CC(Nc2ccccc2SC)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.8368 |
| logD: | 2.8368 |
| logSw: | -3.3566 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.337 |
| InChI Key: | MYRCDRSBZJDLSB-UHFFFAOYSA-N |