[4-(4-methylpiperidine-1-sulfonyl)phenyl](morpholin-4-yl)methanone
Chemical Structure Depiction of
[4-(4-methylpiperidine-1-sulfonyl)phenyl](morpholin-4-yl)methanone
[4-(4-methylpiperidine-1-sulfonyl)phenyl](morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | 8016-2635 |
| Compound Name: | [4-(4-methylpiperidine-1-sulfonyl)phenyl](morpholin-4-yl)methanone |
| Molecular Weight: | 352.45 |
| Molecular Formula: | C17 H24 N2 O4 S |
| Smiles: | CC1CCN(CC1)S(c1ccc(cc1)C(N1CCOCC1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.5146 |
| logD: | 1.5146 |
| logSw: | -2.4039 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 56.506 |
| InChI Key: | LLKBUJXZJMZFOK-UHFFFAOYSA-N |