3-(3,4-dimethoxyphenyl)-N-(quinolin-8-yl)prop-2-enamide
Chemical Structure Depiction of
3-(3,4-dimethoxyphenyl)-N-(quinolin-8-yl)prop-2-enamide
3-(3,4-dimethoxyphenyl)-N-(quinolin-8-yl)prop-2-enamide
Compound characteristics
| Compound ID: | 8016-2715 |
| Compound Name: | 3-(3,4-dimethoxyphenyl)-N-(quinolin-8-yl)prop-2-enamide |
| Molecular Weight: | 334.37 |
| Molecular Formula: | C20 H18 N2 O3 |
| Smiles: | COc1ccc(\C=C/C(Nc2cccc3cccnc23)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 3.8506 |
| logD: | 3.8506 |
| logSw: | -3.8231 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.213 |
| InChI Key: | BCMNEYBTWLFKBY-UHFFFAOYSA-N |