N-[2-(2-chlorophenoxy)ethyl]-2-(3,4-dimethoxyphenyl)acetamide
Chemical Structure Depiction of
N-[2-(2-chlorophenoxy)ethyl]-2-(3,4-dimethoxyphenyl)acetamide
N-[2-(2-chlorophenoxy)ethyl]-2-(3,4-dimethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | 8016-2848 |
| Compound Name: | N-[2-(2-chlorophenoxy)ethyl]-2-(3,4-dimethoxyphenyl)acetamide |
| Molecular Weight: | 349.81 |
| Molecular Formula: | C18 H20 Cl N O4 |
| Smiles: | COc1ccc(CC(NCCOc2ccccc2[Cl])=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 2.7549 |
| logD: | 2.7549 |
| logSw: | -3.2662 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.045 |
| InChI Key: | IYRUYENNYLFVCC-UHFFFAOYSA-N |