5-(4-fluorophenyl)-3-[(piperidin-1-yl)methyl]-1,3,4-oxadiazole-2(3H)-thione
Chemical Structure Depiction of
5-(4-fluorophenyl)-3-[(piperidin-1-yl)methyl]-1,3,4-oxadiazole-2(3H)-thione
5-(4-fluorophenyl)-3-[(piperidin-1-yl)methyl]-1,3,4-oxadiazole-2(3H)-thione
Compound characteristics
| Compound ID: | 8016-3009 |
| Compound Name: | 5-(4-fluorophenyl)-3-[(piperidin-1-yl)methyl]-1,3,4-oxadiazole-2(3H)-thione |
| Molecular Weight: | 293.36 |
| Molecular Formula: | C14 H16 F N3 O S |
| Smiles: | C1CCN(CC1)CN1C(OC(c2ccc(cc2)F)=N1)=S |
| Stereo: | ACHIRAL |
| logP: | 3.1234 |
| logD: | 1.9253 |
| logSw: | -3.1872 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 28.6151 |
| InChI Key: | WWNJNMLFPVAFJN-UHFFFAOYSA-N |