N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-2-(hexyloxy)benzamide
Chemical Structure Depiction of
N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-2-(hexyloxy)benzamide
N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-2-(hexyloxy)benzamide
Compound characteristics
| Compound ID: | 8016-3075 |
| Compound Name: | N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-2-(hexyloxy)benzamide |
| Molecular Weight: | 407.51 |
| Molecular Formula: | C24 H29 N3 O3 |
| Smiles: | CCCCCCOc1ccccc1C(NC1=C(C)N(C)N(C1=O)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0719 |
| logD: | 2.2639 |
| logSw: | -4.146 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.215 |
| InChI Key: | HNAZPSJBFVLDNK-UHFFFAOYSA-N |