2-[2-(2-chlorophenyl)ethenyl]-3-(2,4-dimethylphenyl)-6-iodoquinazolin-4(3H)-one
Chemical Structure Depiction of
2-[2-(2-chlorophenyl)ethenyl]-3-(2,4-dimethylphenyl)-6-iodoquinazolin-4(3H)-one
2-[2-(2-chlorophenyl)ethenyl]-3-(2,4-dimethylphenyl)-6-iodoquinazolin-4(3H)-one
Compound characteristics
| Compound ID: | 8016-3261 |
| Compound Name: | 2-[2-(2-chlorophenyl)ethenyl]-3-(2,4-dimethylphenyl)-6-iodoquinazolin-4(3H)-one |
| Molecular Weight: | 512.78 |
| Molecular Formula: | C24 H18 Cl I N2 O |
| Smiles: | Cc1ccc(c(C)c1)N1C(/C=C/c2ccccc2[Cl])=Nc2ccc(cc2C1=O)I |
| Stereo: | ACHIRAL |
| logP: | 7.5512 |
| logD: | 7.5512 |
| logSw: | -6.398 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.2932 |
| InChI Key: | BCGRSJBKRHXUBH-UHFFFAOYSA-N |