ethyl [3,5-dimethyl-4-(2-phenylacetamido)-1H-pyrazol-1-yl]acetate
Chemical Structure Depiction of
ethyl [3,5-dimethyl-4-(2-phenylacetamido)-1H-pyrazol-1-yl]acetate
ethyl [3,5-dimethyl-4-(2-phenylacetamido)-1H-pyrazol-1-yl]acetate
Compound characteristics
| Compound ID: | 8016-3547 |
| Compound Name: | ethyl [3,5-dimethyl-4-(2-phenylacetamido)-1H-pyrazol-1-yl]acetate |
| Molecular Weight: | 315.37 |
| Molecular Formula: | C17 H21 N3 O3 |
| Smiles: | CCOC(Cn1c(C)c(c(C)n1)NC(Cc1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1711 |
| logD: | 1.1706 |
| logSw: | -2.0108 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.433 |
| InChI Key: | AWPOMKUWGRMRKX-UHFFFAOYSA-N |