4-(2,4,5-trimethoxyphenyl)-3,4-dihydro-2H,5H-pyrano[3,2-c][1]benzopyran-2,5-dione
Chemical Structure Depiction of
4-(2,4,5-trimethoxyphenyl)-3,4-dihydro-2H,5H-pyrano[3,2-c][1]benzopyran-2,5-dione
4-(2,4,5-trimethoxyphenyl)-3,4-dihydro-2H,5H-pyrano[3,2-c][1]benzopyran-2,5-dione
Compound characteristics
| Compound ID: | 8016-4764 |
| Compound Name: | 4-(2,4,5-trimethoxyphenyl)-3,4-dihydro-2H,5H-pyrano[3,2-c][1]benzopyran-2,5-dione |
| Molecular Weight: | 382.37 |
| Molecular Formula: | C21 H18 O7 |
| Smiles: | COc1cc(c(cc1C1CC(=O)OC2=C1C(=O)Oc1ccccc12)OC)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3179 |
| logD: | 2.3179 |
| logSw: | -3.0998 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 64.671 |
| InChI Key: | QQXDWOWOYIGOCI-ZDUSSCGKSA-N |