4-[4-(methylsulfanyl)phenyl]-1-phenyl-4,7-dihydrofuro[3,4-b]pyridine-2,5(1H,3H)-dione
Chemical Structure Depiction of
4-[4-(methylsulfanyl)phenyl]-1-phenyl-4,7-dihydrofuro[3,4-b]pyridine-2,5(1H,3H)-dione
4-[4-(methylsulfanyl)phenyl]-1-phenyl-4,7-dihydrofuro[3,4-b]pyridine-2,5(1H,3H)-dione
Compound characteristics
| Compound ID: | 8016-4780 |
| Compound Name: | 4-[4-(methylsulfanyl)phenyl]-1-phenyl-4,7-dihydrofuro[3,4-b]pyridine-2,5(1H,3H)-dione |
| Molecular Weight: | 351.42 |
| Molecular Formula: | C20 H17 N O3 S |
| Smiles: | CSc1ccc(cc1)C1CC(N(C2COC(C1=2)=O)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0869 |
| logD: | 3.0869 |
| logSw: | -3.1916 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 37.99 |
| InChI Key: | GZGLZKXWSNCMKL-MRXNPFEDSA-N |