N-(2-fluorophenyl)-1-(octylsulfanyl)-9,10-dioxo-9,10-dihydroanthracene-2-carboxamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-1-(octylsulfanyl)-9,10-dioxo-9,10-dihydroanthracene-2-carboxamide
N-(2-fluorophenyl)-1-(octylsulfanyl)-9,10-dioxo-9,10-dihydroanthracene-2-carboxamide
Compound characteristics
| Compound ID: | 8016-4827 |
| Compound Name: | N-(2-fluorophenyl)-1-(octylsulfanyl)-9,10-dioxo-9,10-dihydroanthracene-2-carboxamide |
| Molecular Weight: | 489.61 |
| Molecular Formula: | C29 H28 F N O3 S |
| Smiles: | CCCCCCCCSc1c(ccc2C(c3ccccc3C(c12)=O)=O)C(Nc1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 8.6307 |
| logD: | 8.5735 |
| logSw: | -6.013 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.574 |
| InChI Key: | ZKPWLURSFWTLTQ-UHFFFAOYSA-N |