4-(2-chloro-6-fluorophenyl)-6-methyl-4,6-dihydro-2H-pyrano[3,2-c]quinoline-2,5(3H)-dione
Chemical Structure Depiction of
4-(2-chloro-6-fluorophenyl)-6-methyl-4,6-dihydro-2H-pyrano[3,2-c]quinoline-2,5(3H)-dione
4-(2-chloro-6-fluorophenyl)-6-methyl-4,6-dihydro-2H-pyrano[3,2-c]quinoline-2,5(3H)-dione
Compound characteristics
| Compound ID: | 8016-5223 |
| Compound Name: | 4-(2-chloro-6-fluorophenyl)-6-methyl-4,6-dihydro-2H-pyrano[3,2-c]quinoline-2,5(3H)-dione |
| Molecular Weight: | 357.77 |
| Molecular Formula: | C19 H13 Cl F N O3 |
| Smiles: | CN1C(C2C(CC(=O)OC=2c2ccccc12)c1c(cccc1[Cl])F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9146 |
| logD: | 2.9146 |
| logSw: | -3.759 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.998 |
| InChI Key: | WVOGHHMDRJSZJE-NSHDSACASA-N |