N-(2,5-dichlorophenyl)-2-[(4-ethyl-4H-1,2,4-triazol-3-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-(2,5-dichlorophenyl)-2-[(4-ethyl-4H-1,2,4-triazol-3-yl)sulfanyl]acetamide
N-(2,5-dichlorophenyl)-2-[(4-ethyl-4H-1,2,4-triazol-3-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | 8016-5797 |
| Compound Name: | N-(2,5-dichlorophenyl)-2-[(4-ethyl-4H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| Molecular Weight: | 331.22 |
| Molecular Formula: | C12 H12 Cl2 N4 O S |
| Smiles: | CCn1cnnc1SCC(Nc1cc(ccc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.367 |
| logD: | 2.357 |
| logSw: | -3.2992 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.353 |
| InChI Key: | BMHBHXYJAZIYTN-UHFFFAOYSA-N |