2-butoxy-4-(methoxymethyl)-6-methylpyridine-3-carboxamide
Chemical Structure Depiction of
2-butoxy-4-(methoxymethyl)-6-methylpyridine-3-carboxamide
2-butoxy-4-(methoxymethyl)-6-methylpyridine-3-carboxamide
Compound characteristics
| Compound ID: | 8016-5809 |
| Compound Name: | 2-butoxy-4-(methoxymethyl)-6-methylpyridine-3-carboxamide |
| Molecular Weight: | 252.31 |
| Molecular Formula: | C13 H20 N2 O3 |
| Smiles: | CCCCOc1c(C(N)=O)c(COC)cc(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 1.0937 |
| logD: | 1.0937 |
| logSw: | -1.4397 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.319 |
| InChI Key: | MIZVMHTUGWONDY-UHFFFAOYSA-N |