3-amino-N-benzyl-4-(methoxymethyl)-N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide
Chemical Structure Depiction of
3-amino-N-benzyl-4-(methoxymethyl)-N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide
3-amino-N-benzyl-4-(methoxymethyl)-N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide
Compound characteristics
| Compound ID: | 8016-5822 |
| Compound Name: | 3-amino-N-benzyl-4-(methoxymethyl)-N,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| Molecular Weight: | 355.46 |
| Molecular Formula: | C19 H21 N3 O2 S |
| Smiles: | Cc1cc(COC)c2c(c(C(N(C)Cc3ccccc3)=O)sc2n1)N |
| Stereo: | ACHIRAL |
| logP: | 3.0656 |
| logD: | 3.0533 |
| logSw: | -3.3516 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.726 |
| InChI Key: | AOWWRTOFFRLDGC-UHFFFAOYSA-N |