2-[(2,4-dimethoxyphenyl)methyl]-1-oxo-1,2,3,6,7,7a-hexahydro-3a,6-epoxyisoindole-7-carboxylic acid
Chemical Structure Depiction of
2-[(2,4-dimethoxyphenyl)methyl]-1-oxo-1,2,3,6,7,7a-hexahydro-3a,6-epoxyisoindole-7-carboxylic acid
2-[(2,4-dimethoxyphenyl)methyl]-1-oxo-1,2,3,6,7,7a-hexahydro-3a,6-epoxyisoindole-7-carboxylic acid
Compound characteristics
| Compound ID: | 8016-6926 |
| Compound Name: | 2-[(2,4-dimethoxyphenyl)methyl]-1-oxo-1,2,3,6,7,7a-hexahydro-3a,6-epoxyisoindole-7-carboxylic acid |
| Molecular Weight: | 345.35 |
| Molecular Formula: | C18 H19 N O6 |
| Smiles: | COc1ccc(CN2CC34C=CC(C(C3C2=O)C(O)=O)O4)c(c1)OC |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 1.349 |
| logD: | -0.8724 |
| logSw: | -1.9922 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.13 |
| InChI Key: | WNWZAJDOAPWELA-UHFFFAOYSA-N |