3-(1,3-benzoxazol-2-yl)-1,1,1-trifluoropropan-2-one
Chemical Structure Depiction of
3-(1,3-benzoxazol-2-yl)-1,1,1-trifluoropropan-2-one
3-(1,3-benzoxazol-2-yl)-1,1,1-trifluoropropan-2-one
Compound characteristics
| Compound ID: | 8016-6934 |
| Compound Name: | 3-(1,3-benzoxazol-2-yl)-1,1,1-trifluoropropan-2-one |
| Molecular Weight: | 229.16 |
| Molecular Formula: | C10 H6 F3 N O2 |
| Smiles: | C(C(C(F)(F)F)=O)c1nc2ccccc2o1 |
| Stereo: | ACHIRAL |
| logP: | 2.6631 |
| logD: | 2.6631 |
| logSw: | -2.7485 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.2328 |
| InChI Key: | OWVYBMYMYZKXOR-UHFFFAOYSA-N |