4-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-4,7-dihydrofuro[3,4-b]pyridine-2,5(1H,3H)-dione
Chemical Structure Depiction of
4-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-4,7-dihydrofuro[3,4-b]pyridine-2,5(1H,3H)-dione
4-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-4,7-dihydrofuro[3,4-b]pyridine-2,5(1H,3H)-dione
Compound characteristics
| Compound ID: | 8016-7095 |
| Compound Name: | 4-(3-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-4,7-dihydrofuro[3,4-b]pyridine-2,5(1H,3H)-dione |
| Molecular Weight: | 407.77 |
| Molecular Formula: | C20 H13 Cl F3 N O3 |
| Smiles: | C1C(C2=C(COC2=O)N(C1=O)c1cccc(c1)C(F)(F)F)c1cccc(c1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9854 |
| logD: | 3.9854 |
| logSw: | -4.5174 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.99 |
| InChI Key: | VVGOVFSJKISCDN-OAHLLOKOSA-N |