methyl 2-{[4-(ethoxycarbonyl)phenyl]imino}-3-(3-methylbutyl)-4-oxo-3,4-dihydro-2H-1,3-thiazine-6-carboxylate
Chemical Structure Depiction of
methyl 2-{[4-(ethoxycarbonyl)phenyl]imino}-3-(3-methylbutyl)-4-oxo-3,4-dihydro-2H-1,3-thiazine-6-carboxylate
methyl 2-{[4-(ethoxycarbonyl)phenyl]imino}-3-(3-methylbutyl)-4-oxo-3,4-dihydro-2H-1,3-thiazine-6-carboxylate
Compound characteristics
| Compound ID: | 8016-7408 |
| Compound Name: | methyl 2-{[4-(ethoxycarbonyl)phenyl]imino}-3-(3-methylbutyl)-4-oxo-3,4-dihydro-2H-1,3-thiazine-6-carboxylate |
| Molecular Weight: | 404.48 |
| Molecular Formula: | C20 H24 N2 O5 S |
| Smiles: | CCOC(c1ccc(cc1)/N=C1/N(CCC(C)C)C(C=C(C(=O)OC)S1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3417 |
| logD: | 4.3417 |
| logSw: | -4.111 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 67.225 |
| InChI Key: | QGTHABNITXRZAT-UHFFFAOYSA-N |