methyl 6-oxo-3,4-dihydro-2H,6H-[1,3]thiazino[2,3-b]quinazoline-9-carboxylate
Chemical Structure Depiction of
methyl 6-oxo-3,4-dihydro-2H,6H-[1,3]thiazino[2,3-b]quinazoline-9-carboxylate
methyl 6-oxo-3,4-dihydro-2H,6H-[1,3]thiazino[2,3-b]quinazoline-9-carboxylate
Compound characteristics
| Compound ID: | 8016-8017 |
| Compound Name: | methyl 6-oxo-3,4-dihydro-2H,6H-[1,3]thiazino[2,3-b]quinazoline-9-carboxylate |
| Molecular Weight: | 276.31 |
| Molecular Formula: | C13 H12 N2 O3 S |
| Smiles: | COC(c1ccc2C(N3CCCSC3=Nc2c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0859 |
| logD: | 2.0859 |
| logSw: | -2.8899 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 47.165 |
| InChI Key: | QHESFROOEZPTFF-UHFFFAOYSA-N |