2-(benzylsulfanyl)[1,3]thiazolo[4,5-b]pyridine-5,7-diol
Chemical Structure Depiction of
2-(benzylsulfanyl)[1,3]thiazolo[4,5-b]pyridine-5,7-diol
2-(benzylsulfanyl)[1,3]thiazolo[4,5-b]pyridine-5,7-diol
Compound characteristics
| Compound ID: | 8016-8326 |
| Compound Name: | 2-(benzylsulfanyl)[1,3]thiazolo[4,5-b]pyridine-5,7-diol |
| Molecular Weight: | 290.36 |
| Molecular Formula: | C13 H10 N2 O2 S2 |
| Smiles: | C(c1ccccc1)Sc1nc2c(c(cc(n2)O)O)s1 |
| Stereo: | ACHIRAL |
| logP: | 3.2097 |
| logD: | 2.0836 |
| logSw: | -3.0063 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.797 |
| InChI Key: | ZAUDDKNYHZCYSJ-UHFFFAOYSA-N |