2-(benzylamino)-4-(methoxymethyl)-6-methylpyridine-3-carboxamide
Chemical Structure Depiction of
2-(benzylamino)-4-(methoxymethyl)-6-methylpyridine-3-carboxamide
2-(benzylamino)-4-(methoxymethyl)-6-methylpyridine-3-carboxamide
Compound characteristics
| Compound ID: | 8016-8654 |
| Compound Name: | 2-(benzylamino)-4-(methoxymethyl)-6-methylpyridine-3-carboxamide |
| Molecular Weight: | 285.34 |
| Molecular Formula: | C16 H19 N3 O2 |
| Smiles: | Cc1cc(COC)c(C(N)=O)c(NCc2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 0.7219 |
| logD: | 0.7198 |
| logSw: | -1.7218 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 62.018 |
| InChI Key: | FQRRXAVYJYPOOW-UHFFFAOYSA-N |