(2-chlorophenyl)methyl 4-(1H-pyrazol-1-yl)benzoate
Chemical Structure Depiction of
(2-chlorophenyl)methyl 4-(1H-pyrazol-1-yl)benzoate
(2-chlorophenyl)methyl 4-(1H-pyrazol-1-yl)benzoate
Compound characteristics
| Compound ID: | 8016-8890 |
| Compound Name: | (2-chlorophenyl)methyl 4-(1H-pyrazol-1-yl)benzoate |
| Molecular Weight: | 312.75 |
| Molecular Formula: | C17 H13 Cl N2 O2 |
| Smiles: | C(c1ccccc1[Cl])OC(c1ccc(cc1)n1cccn1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3064 |
| logD: | 4.3064 |
| logSw: | -4.4831 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.471 |
| InChI Key: | KZGWHXAQJKRUGB-UHFFFAOYSA-N |