7-methyl-3-oxo-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide
Chemical Structure Depiction of
7-methyl-3-oxo-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide
7-methyl-3-oxo-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide
Compound characteristics
| Compound ID: | 8016-9136 |
| Compound Name: | 7-methyl-3-oxo-N-propyl-3,4-dihydro-2H-1,4-benzoxazine-6-sulfonamide |
| Molecular Weight: | 284.33 |
| Molecular Formula: | C12 H16 N2 O4 S |
| Smiles: | CCCNS(c1cc2c(cc1C)OCC(N2)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.4636 |
| logD: | 1.4634 |
| logSw: | -2.2959 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.38 |
| InChI Key: | RZUWSSAOEKWSMP-UHFFFAOYSA-N |