N-(adamantan-1-yl)-N'-[2-(phenylsulfanyl)ethyl]urea
Chemical Structure Depiction of
N-(adamantan-1-yl)-N'-[2-(phenylsulfanyl)ethyl]urea
N-(adamantan-1-yl)-N'-[2-(phenylsulfanyl)ethyl]urea
Compound characteristics
| Compound ID: | 8016-9598 |
| Compound Name: | N-(adamantan-1-yl)-N'-[2-(phenylsulfanyl)ethyl]urea |
| Molecular Weight: | 330.49 |
| Molecular Formula: | C19 H26 N2 O S |
| Smiles: | C1C2CC3CC1CC(C2)(C3)NC(NCCSc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.179 |
| logD: | 4.1787 |
| logSw: | -4.3162 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.723 |
| InChI Key: | CHWFZROVGLBBIH-UHFFFAOYSA-N |